Products 1261397-74-3
CAS 1261397-74-3 is the registry number for Metronidazole-d4 (hydrochloride). Offered by: MedChemExpress. Available pack sizes: 1mg, 5mg.
1,1,2,2-tetradeuterio-2-(2-methyl-5-nitroimidazol-1-yl)ethanol;hydrochloride (CAS 1261397-74-3) is a chemical compound with the molecular formula C6H10ClN3O3 and a molecular weight of 211.64 g/mol. IUPAC name: 1,1,2,2-tetradeuterio-2-(2-methyl-5-nitroimidazol-1-yl)ethanol;hydrochloride. InChIKey: FPTPAIQTXYFGJC-DAHDXRBSSA-N.
| Molecular formula | C6H10ClN3O3 |
|---|---|
| Molecular weight | 211.64 g/mol |
| IUPAC name | 1,1,2,2-tetradeuterio-2-(2-methyl-5-nitroimidazol-1-yl)ethanol;hydrochloride |
| InChIKey | FPTPAIQTXYFGJC-DAHDXRBSSA-N |
| SMILES | [2H]C([2H])(C([2H])([2H])O)N1C(=NC=C1[N+](=O)[O-])C.Cl |
Computed by PubChem (NCBI)