Products 220195-81-3
CAS 220195-81-3 is the registry number for (βS)-β-Hydroxy-L-histidine (hydrochloride). Offered by: MedChemExpress. Available pack sizes: Get quote.
(2S,3S)-2-amino-3-hydroxy-3-(1H-imidazol-5-yl)propanoic acid;hydrochloride (CAS 220195-81-3) is a chemical compound with the molecular formula C6H10ClN3O3 and a molecular weight of 207.61 g/mol. IUPAC name: (2S,3S)-2-amino-3-hydroxy-3-(1H-imidazol-5-yl)propanoic acid;hydrochloride. InChIKey: LQDUIZNPJZDBTI-UYXJWNHNSA-N.
| Molecular formula | C6H10ClN3O3 |
|---|---|
| Molecular weight | 207.61 g/mol |
| IUPAC name | (2S,3S)-2-amino-3-hydroxy-3-(1H-imidazol-5-yl)propanoic acid;hydrochloride |
| InChIKey | LQDUIZNPJZDBTI-UYXJWNHNSA-N |
| SMILES | C1=C(NC=N1)[C@H]([C@@H](C(=O)O)N)O.Cl |
Computed by PubChem (NCBI)