CAS 2368852-01-9 appears in our catalog under these names: 2,4,6–Triaminobenzene–1,3,5–triol hydrochloride, 2,4,6-Triaminobenzene-1,3,5-triol trihydrochloride 95%. Offered by: GLPBio, Ambeed. Available pack sizes: 1g, 50mg, 100mg, 250mg, 5g.
2,4,6-triaminobenzene-1,3,5-triol;hydrochloride (CAS 2368852-01-9) is a chemical compound with the molecular formula C6H10ClN3O3 and a molecular weight of 207.61 g/mol. IUPAC name: 2,4,6-triaminobenzene-1,3,5-triol;hydrochloride. InChIKey: TWHHEJMSBIMVHF-UHFFFAOYSA-N.
| Molecular formula | C6H10ClN3O3 |
|---|---|
| Molecular weight | 207.61 g/mol |
| IUPAC name | 2,4,6-triaminobenzene-1,3,5-triol;hydrochloride |
| InChIKey | TWHHEJMSBIMVHF-UHFFFAOYSA-N |
| SMILES | C1(=C(C(=C(C(=C1O)N)O)N)O)N.Cl |
Computed by PubChem (NCBI)