CAS 1261482-51-2 appears in our catalog under these names: 4-(bromomethyl)-2-iodo-1-(trifluoromethyl)benzene, 95%, 3-Iodo-4-(trifluoromethyl)benzyl bromide, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
4-(bromomethyl)-2-iodo-1-(trifluoromethyl)benzene (CAS 1261482-51-2) is a chemical compound with the molecular formula C8H5BrF3I and a molecular weight of 364.93 g/mol. IUPAC name: 4-(bromomethyl)-2-iodo-1-(trifluoromethyl)benzene. InChIKey: JMEZQPBWYYKMDA-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF3I |
|---|---|
| Molecular weight | 364.93 g/mol |
| IUPAC name | 4-(bromomethyl)-2-iodo-1-(trifluoromethyl)benzene |
| InChIKey | JMEZQPBWYYKMDA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CBr)I)C(F)(F)F |
Computed by PubChem (NCBI)