CAS 939758-31-3 appears in our catalog under these names: 2–Iodo–4–(trifluoromethyl)benzyl bromide, 2-Iodo-4-(trifluoromethyl)benzyl bromide. Offered by: GLPBio, Biosynth. Available pack sizes: 250mg, 2,5g.
1-(bromomethyl)-2-iodo-4-(trifluoromethyl)benzene (CAS 939758-31-3) is a chemical compound with the molecular formula C8H5BrF3I and a molecular weight of 364.93 g/mol. IUPAC name: 1-(bromomethyl)-2-iodo-4-(trifluoromethyl)benzene. InChIKey: DOHGQLWLCHNEKB-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF3I |
|---|---|
| Molecular weight | 364.93 g/mol |
| IUPAC name | 1-(bromomethyl)-2-iodo-4-(trifluoromethyl)benzene |
| InChIKey | DOHGQLWLCHNEKB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)I)CBr |
Computed by PubChem (NCBI)