CAS 1261682-47-6 appears in our catalog under these names: 2-(Bromomethyl)-4-iodo-1-(trifluoromethyl)benzene, 90%, 90%, 5-IODO-2-(TRIFLUOROMETHYL)BENZYL BROMIDE, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg.
2-(bromomethyl)-4-iodo-1-(trifluoromethyl)benzene (CAS 1261682-47-6) is a chemical compound with the molecular formula C8H5BrF3I and a molecular weight of 364.93 g/mol. IUPAC name: 2-(bromomethyl)-4-iodo-1-(trifluoromethyl)benzene. InChIKey: YQXCBZJKBGFVGB-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF3I |
|---|---|
| Molecular weight | 364.93 g/mol |
| IUPAC name | 2-(bromomethyl)-4-iodo-1-(trifluoromethyl)benzene |
| InChIKey | YQXCBZJKBGFVGB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1I)CBr)C(F)(F)F |
Computed by PubChem (NCBI)