Products 1261552-11-7
CAS 1261552-11-7 appears in our catalog under these names: 2-(3-Bromo-4-chlorophenyl)-2-hydroxyacetic acid, 95%, 2-(3-Bromo-4-chlorophenyl)-2-hydroxyacetic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
2-(3-bromo-4-chlorophenyl)-2-hydroxyacetic acid (CAS 1261552-11-7) is a chemical compound with the molecular formula C8H6BrClO3 and a molecular weight of 265.49 g/mol. IUPAC name: 2-(3-bromo-4-chlorophenyl)-2-hydroxyacetic acid. InChIKey: BLQLDUGKXMFTKB-UHFFFAOYSA-N.
| Molecular formula | C8H6BrClO3 |
|---|---|
| Molecular weight | 265.49 g/mol |
| IUPAC name | 2-(3-bromo-4-chlorophenyl)-2-hydroxyacetic acid |
| InChIKey | BLQLDUGKXMFTKB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(C(=O)O)O)Br)Cl |
Computed by PubChem (NCBI)