CAS 1261589-18-7 appears in our catalog under these names: 7-Fluoroquinolin-6-ol, 7-Fluoroquinolin-6-ol, 97%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 1g.
7-fluoroquinolin-6-ol (CAS 1261589-18-7) is a chemical compound with the molecular formula C9H6FNO and a molecular weight of 163.15 g/mol. IUPAC name: 7-fluoroquinolin-6-ol. InChIKey: YPLIUEGYORBPNO-UHFFFAOYSA-N.
| Molecular formula | C9H6FNO |
|---|---|
| Molecular weight | 163.15 g/mol |
| IUPAC name | 7-fluoroquinolin-6-ol |
| InChIKey | YPLIUEGYORBPNO-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC(=C(C=C2N=C1)F)O |
Computed by PubChem (NCBI)