CAS 1261602-78-1 appears in our catalog under these names: 7-Fluoroquinolin-5-ol, 95%, 7-fluoroquinolin-5-ol, 95%, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg.
7-fluoroquinolin-5-ol (CAS 1261602-78-1) is a chemical compound with the molecular formula C9H6FNO and a molecular weight of 163.15 g/mol. IUPAC name: 7-fluoroquinolin-5-ol. InChIKey: FUYGHHLBDSWSQT-UHFFFAOYSA-N.
| Molecular formula | C9H6FNO |
|---|---|
| Molecular weight | 163.15 g/mol |
| IUPAC name | 7-fluoroquinolin-5-ol |
| InChIKey | FUYGHHLBDSWSQT-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C(C=C2O)F)N=C1 |
Computed by PubChem (NCBI)