CAS 126162-96-7 appears in our catalog under these names: 4-Ethoxy-2,3-difluorobenzonitrile 98+%, 2,3-Difluoro-4-ethoxybenzonitrile, 98%. Offered by: Ambeed, Fluorochem. Available pack sizes: 1g, 5g, 25g, 100g, 10g.
4-ethoxy-2,3-difluorobenzonitrile (CAS 126162-96-7) is a chemical compound with the molecular formula C9H7F2NO and a molecular weight of 183.15 g/mol. IUPAC name: 4-ethoxy-2,3-difluorobenzonitrile. InChIKey: NVCHMZSUFSRXTF-UHFFFAOYSA-N.
| Molecular formula | C9H7F2NO |
|---|---|
| Molecular weight | 183.15 g/mol |
| IUPAC name | 4-ethoxy-2,3-difluorobenzonitrile |
| InChIKey | NVCHMZSUFSRXTF-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C(=C(C=C1)C#N)F)F |
Computed by PubChem (NCBI)