Products 1261640-05-4
CAS 1261640-05-4 is the registry number for 1-(2-Amino-4-bromophenyl)-2-chloroethanone, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-(2-amino-4-bromophenyl)-2-chloroethanone (CAS 1261640-05-4) is a chemical compound with the molecular formula C8H7BrClNO and a molecular weight of 248.50 g/mol. IUPAC name: 1-(2-amino-4-bromophenyl)-2-chloroethanone. InChIKey: YSWJPPKANFSCQS-UHFFFAOYSA-N.
| Molecular formula | C8H7BrClNO |
|---|---|
| Molecular weight | 248.50 g/mol |
| IUPAC name | 1-(2-amino-4-bromophenyl)-2-chloroethanone |
| InChIKey | YSWJPPKANFSCQS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)N)C(=O)CCl |
Computed by PubChem (NCBI)