CAS 1261645-50-4 appears in our catalog under these names: (2-(Difluoromethoxy)-3-fluorophenyl)methanamine, 95+%, (2-(Difluoromethoxy)-3-fluorophenyl)methanamine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
[2-(difluoromethoxy)-3-fluorophenyl]methanamine (CAS 1261645-50-4) is a chemical compound with the molecular formula C8H8F3NO and a molecular weight of 191.15 g/mol. IUPAC name: [2-(difluoromethoxy)-3-fluorophenyl]methanamine. InChIKey: BUOXMGCLFIDKNH-UHFFFAOYSA-N.
| Molecular formula | C8H8F3NO |
|---|---|
| Molecular weight | 191.15 g/mol |
| IUPAC name | [2-(difluoromethoxy)-3-fluorophenyl]methanamine |
| InChIKey | BUOXMGCLFIDKNH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)OC(F)F)CN |
Computed by PubChem (NCBI)