Products 1261666-52-7
CAS 1261666-52-7 is the registry number for 5-Amino-2-bromophenylacetic acid, 98%, 98%. Offered by: Chemat. Available pack sizes: 1g.
2-(5-amino-2-bromophenyl)acetic acid (CAS 1261666-52-7) is a chemical compound with the molecular formula C8H8BrNO2 and a molecular weight of 230.06 g/mol. IUPAC name: 2-(5-amino-2-bromophenyl)acetic acid. InChIKey: MCJGOEVGJGFUKG-UHFFFAOYSA-N.
| Molecular formula | C8H8BrNO2 |
|---|---|
| Molecular weight | 230.06 g/mol |
| IUPAC name | 2-(5-amino-2-bromophenyl)acetic acid |
| InChIKey | MCJGOEVGJGFUKG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N)CC(=O)O)Br |
Computed by PubChem (NCBI)