Products 1261670-46-5

CAS 1261670-46-5 is the registry number for 2-(2-Bromo-6-chlorophenyl)-2-hydroxyacetic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-(2-bromo-6-chlorophenyl)-2-hydroxyacetic acid (CAS 1261670-46-5) is a chemical compound with the molecular formula C8H6BrClO3 and a molecular weight of 265.49 g/mol. IUPAC name: 2-(2-bromo-6-chlorophenyl)-2-hydroxyacetic acid. InChIKey: DRAQMKALONHACC-UHFFFAOYSA-N.

Identity
Molecular formulaC8H6BrClO3
Molecular weight265.49 g/mol
IUPAC name2-(2-bromo-6-chlorophenyl)-2-hydroxyacetic acid
InChIKeyDRAQMKALONHACC-UHFFFAOYSA-N
SMILESC1=CC(=C(C(=C1)Br)C(C(=O)O)O)Cl

Computed by PubChem (NCBI)