Products 1261738-66-2
CAS 1261738-66-2 appears in our catalog under these names: 3-(Difluoromethoxy)-5-fluorobenzene-1-sulfonamide, 95%, 3-(Difluoromethoxy)-5-fluorobenzene-1-sulfonamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
3-(difluoromethoxy)-5-fluorobenzenesulfonamide (CAS 1261738-66-2) is a chemical compound with the molecular formula C7H6F3NO3S and a molecular weight of 241.19 g/mol. IUPAC name: 3-(difluoromethoxy)-5-fluorobenzenesulfonamide. InChIKey: PQNHVQAXRICMSV-UHFFFAOYSA-N.
| Molecular formula | C7H6F3NO3S |
|---|---|
| Molecular weight | 241.19 g/mol |
| IUPAC name | 3-(difluoromethoxy)-5-fluorobenzenesulfonamide |
| InChIKey | PQNHVQAXRICMSV-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1F)S(=O)(=O)N)OC(F)F |
Computed by PubChem (NCBI)