CAS 1513-44-6 is the registry number for 2-Amino-4-(trifluoromethyl)benzenesulfonic acid, 97%. Offered by: AmBeed. Available pack sizes: 10g.
2-amino-4-(trifluoromethyl)benzenesulfonic acid (CAS 1513-44-6) is a chemical compound with the molecular formula C7H6F3NO3S and a molecular weight of 241.19 g/mol. IUPAC name: 2-amino-4-(trifluoromethyl)benzenesulfonic acid. InChIKey: LHIOGENQCVAALC-UHFFFAOYSA-N.
| Molecular formula | C7H6F3NO3S |
|---|---|
| Molecular weight | 241.19 g/mol |
| IUPAC name | 2-amino-4-(trifluoromethyl)benzenesulfonic acid |
| InChIKey | LHIOGENQCVAALC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)N)S(=O)(=O)O |
Computed by PubChem (NCBI)