CAS 544652-92-8 is the registry number for Ethyl 4-hydroxy-2-(trifluoromethyl)thiazole-5-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 4-hydroxy-2-(trifluoromethyl)-1,3-thiazole-5-carboxylate (CAS 544652-92-8) is a chemical compound with the molecular formula C7H6F3NO3S and a molecular weight of 241.19 g/mol. IUPAC name: ethyl 4-hydroxy-2-(trifluoromethyl)-1,3-thiazole-5-carboxylate. InChIKey: GFNCNGUXIJXFIW-UHFFFAOYSA-N.
| Molecular formula | C7H6F3NO3S |
|---|---|
| Molecular weight | 241.19 g/mol |
| IUPAC name | ethyl 4-hydroxy-2-(trifluoromethyl)-1,3-thiazole-5-carboxylate |
| InChIKey | GFNCNGUXIJXFIW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N=C(S1)C(F)(F)F)O |
Computed by PubChem (NCBI)