CAS 1261747-80-1 appears in our catalog under these names: Pantoprazole Impurity 40, 4-(Difluoromethoxy)-3-nitroaniline 95%, 4-(Difluoromethoxy)-3-nitroaniline, 95%, 95%. Offered by: Chemat Brand, Ambeed, Chemat. Available pack sizes: on request, 50mg, 100mg, 250mg, 1g.
4-(difluoromethoxy)-3-nitroaniline (CAS 1261747-80-1) is a chemical compound with the molecular formula C7H6F2N2O3 and a molecular weight of 204.13 g/mol. IUPAC name: 4-(difluoromethoxy)-3-nitroaniline. InChIKey: CLEFQRLFZVWEJD-UHFFFAOYSA-N.
| Molecular formula | C7H6F2N2O3 |
|---|---|
| Molecular weight | 204.13 g/mol |
| IUPAC name | 4-(difluoromethoxy)-3-nitroaniline |
| InChIKey | CLEFQRLFZVWEJD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N)[N+](=O)[O-])OC(F)F |
Computed by PubChem (NCBI)