Products 2925477-21-8
CAS 2925477-21-8 is the registry number for (E)-3-(3-(1,1-Difluoroethyl)-1,2,4-oxadiazol-5-yl)acrylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(E)-3-[3-(1,1-difluoroethyl)-1,2,4-oxadiazol-5-yl]prop-2-enoic acid (CAS 2925477-21-8) is a chemical compound with the molecular formula C7H6F2N2O3 and a molecular weight of 204.13 g/mol. IUPAC name: (E)-3-[3-(1,1-difluoroethyl)-1,2,4-oxadiazol-5-yl]prop-2-enoic acid. InChIKey: PTKJMCRTZFNBIU-NSCUHMNNSA-N.
| Molecular formula | C7H6F2N2O3 |
|---|---|
| Molecular weight | 204.13 g/mol |
| IUPAC name | (E)-3-[3-(1,1-difluoroethyl)-1,2,4-oxadiazol-5-yl]prop-2-enoic acid |
| InChIKey | PTKJMCRTZFNBIU-NSCUHMNNSA-N |
| SMILES | CC(C1=NOC(=N1)/C=C/C(=O)O)(F)F |
Computed by PubChem (NCBI)