Products 2173093-27-9
CAS 2173093-27-9 is the registry number for 3,5-Difluoro-2-methoxy-4-nitroaniline, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 25g, 10g.
3,5-difluoro-2-methoxy-4-nitroaniline (CAS 2173093-27-9) is a chemical compound with the molecular formula C7H6F2N2O3 and a molecular weight of 204.13 g/mol. IUPAC name: 3,5-difluoro-2-methoxy-4-nitroaniline. InChIKey: QWLHYONWYHNMQU-UHFFFAOYSA-N.
| Molecular formula | C7H6F2N2O3 |
|---|---|
| Molecular weight | 204.13 g/mol |
| IUPAC name | 3,5-difluoro-2-methoxy-4-nitroaniline |
| InChIKey | QWLHYONWYHNMQU-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1N)F)[N+](=O)[O-])F |
Computed by PubChem (NCBI)