Products 126176-61-2

CAS 126176-61-2 is the registry number for Ibuprofen Impurity 36. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

(3-hydroxy-2,2-dimethylpropyl) 2-[4-(2-methylpropyl)phenyl]propanoate (CAS 126176-61-2) is a chemical compound with the molecular formula C18H28O3 and a molecular weight of 292.4 g/mol. IUPAC name: (3-hydroxy-2,2-dimethylpropyl) 2-[4-(2-methylpropyl)phenyl]propanoate. InChIKey: CGZZLQKELPZPEH-UHFFFAOYSA-N.

Identity
Molecular formulaC18H28O3
Molecular weight292.4 g/mol
IUPAC name(3-hydroxy-2,2-dimethylpropyl) 2-[4-(2-methylpropyl)phenyl]propanoate
InChIKeyCGZZLQKELPZPEH-UHFFFAOYSA-N
SMILESCC(C)CC1=CC=C(C=C1)C(C)C(=O)OCC(C)(C)CO

Computed by PubChem (NCBI)