Products 154021-24-6

CAS 154021-24-6 is the registry number for Gemfibrozil Isopropyl Ester. Offered by: Mikromol. Available pack sizes: 100mg.

Structural formula: {0} (CAS {1})

Propan-2-yl 5-(2,5-dimethylphenoxy)-2,2-dimethylpentanoate (CAS 154021-24-6) is a chemical compound with the molecular formula C18H28O3 and a molecular weight of 292.4 g/mol. IUPAC name: propan-2-yl 5-(2,5-dimethylphenoxy)-2,2-dimethylpentanoate. InChIKey: DZJZKDUBUILQPJ-UHFFFAOYSA-N.

Identity
Molecular formulaC18H28O3
Molecular weight292.4 g/mol
IUPAC namepropan-2-yl 5-(2,5-dimethylphenoxy)-2,2-dimethylpentanoate
InChIKeyDZJZKDUBUILQPJ-UHFFFAOYSA-N
SMILESCC1=CC(=C(C=C1)C)OCCCC(C)(C)C(=O)OC(C)C

Computed by PubChem (NCBI)