Products 1368025-62-0
CAS 1368025-62-0 is the registry number for 3,5-di-tert-butyl-4-isopropoxybenzoic acid. Offered by: Chemat Brand. Available pack sizes: on request.
3,5-ditert-butyl-4-propan-2-yloxybenzoic acid (CAS 1368025-62-0) is a chemical compound with the molecular formula C18H28O3 and a molecular weight of 292.4 g/mol. IUPAC name: 3,5-ditert-butyl-4-propan-2-yloxybenzoic acid. InChIKey: WYKAQQGWQFOIFW-UHFFFAOYSA-N.
| Molecular formula | C18H28O3 |
|---|---|
| Molecular weight | 292.4 g/mol |
| IUPAC name | 3,5-ditert-butyl-4-propan-2-yloxybenzoic acid |
| InChIKey | WYKAQQGWQFOIFW-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=C(C=C(C=C1C(C)(C)C)C(=O)O)C(C)(C)C |
Computed by PubChem (NCBI)