Products 1261765-47-2
CAS 1261765-47-2 is the registry number for 4-(2,3-Difluorophenyl)-2-fluorophenol, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
4-(2,3-difluorophenyl)-2-fluorophenol (CAS 1261765-47-2) is a chemical compound with the molecular formula C12H7F3O and a molecular weight of 224.18 g/mol. IUPAC name: 4-(2,3-difluorophenyl)-2-fluorophenol. InChIKey: STPKPWGELDDWIB-UHFFFAOYSA-N.
| Molecular formula | C12H7F3O |
|---|---|
| Molecular weight | 224.18 g/mol |
| IUPAC name | 4-(2,3-difluorophenyl)-2-fluorophenol |
| InChIKey | STPKPWGELDDWIB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)F)C2=CC(=C(C=C2)O)F |
Computed by PubChem (NCBI)