CAS 1261950-48-4 is the registry number for 4-(3,5-Difluorophenyl)-2-fluorophenol, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
4-(3,5-difluorophenyl)-2-fluorophenol (CAS 1261950-48-4) is a chemical compound with the molecular formula C12H7F3O and a molecular weight of 224.18 g/mol. IUPAC name: 4-(3,5-difluorophenyl)-2-fluorophenol. InChIKey: OAAFYLDTBQUEPF-UHFFFAOYSA-N.
| Molecular formula | C12H7F3O |
|---|---|
| Molecular weight | 224.18 g/mol |
| IUPAC name | 4-(3,5-difluorophenyl)-2-fluorophenol |
| InChIKey | OAAFYLDTBQUEPF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C2=CC(=CC(=C2)F)F)F)O |
Computed by PubChem (NCBI)