Products 1690837-37-6
CAS 1690837-37-6 is the registry number for 2,2-Difluoro-1-(4-fluoronaphthalen-1-yl)ethan-1-one, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2,2-difluoro-1-(4-fluoronaphthalen-1-yl)ethanone (CAS 1690837-37-6) is a chemical compound with the molecular formula C12H7F3O and a molecular weight of 224.18 g/mol. IUPAC name: 2,2-difluoro-1-(4-fluoronaphthalen-1-yl)ethanone. InChIKey: KNNGMJOLTDYPQB-UHFFFAOYSA-N.
| Molecular formula | C12H7F3O |
|---|---|
| Molecular weight | 224.18 g/mol |
| IUPAC name | 2,2-difluoro-1-(4-fluoronaphthalen-1-yl)ethanone |
| InChIKey | KNNGMJOLTDYPQB-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC=C2F)C(=O)C(F)F |
Computed by PubChem (NCBI)