Products 1261794-69-7
CAS 1261794-69-7 is the registry number for 1-(Chloromethyl)-3-iodo-5-nitrobenzene. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-(chloromethyl)-3-iodo-5-nitrobenzene (CAS 1261794-69-7) is a chemical compound with the molecular formula C7H5ClINO2 and a molecular weight of 297.48 g/mol. IUPAC name: 1-(chloromethyl)-3-iodo-5-nitrobenzene. InChIKey: UEFFDIXVKYRIRM-UHFFFAOYSA-N.
| Molecular formula | C7H5ClINO2 |
|---|---|
| Molecular weight | 297.48 g/mol |
| IUPAC name | 1-(chloromethyl)-3-iodo-5-nitrobenzene |
| InChIKey | UEFFDIXVKYRIRM-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1[N+](=O)[O-])I)CCl |
Computed by PubChem (NCBI)