CAS 1261802-02-1 appears in our catalog under these names: 2-Fluoroquinolin-7-ol, 95%, 2-Fluoroquinolin-7-ol. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-fluoroquinolin-7-ol (CAS 1261802-02-1) is a chemical compound with the molecular formula C9H6FNO and a molecular weight of 163.15 g/mol. IUPAC name: 2-fluoroquinolin-7-ol. InChIKey: VDSHNXNIGOYZFN-UHFFFAOYSA-N.
| Molecular formula | C9H6FNO |
|---|---|
| Molecular weight | 163.15 g/mol |
| IUPAC name | 2-fluoroquinolin-7-ol |
| InChIKey | VDSHNXNIGOYZFN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC2=C1C=CC(=N2)F)O |
Computed by PubChem (NCBI)