CAS 1261857-65-1 is the registry number for 2-Chloro-5-methyl-4'-(trifluoromethyl)-1,1'-biphenyl, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-chloro-4-methyl-2-[4-(trifluoromethyl)phenyl]benzene (CAS 1261857-65-1) is a chemical compound with the molecular formula C14H10ClF3 and a molecular weight of 270.67 g/mol. IUPAC name: 1-chloro-4-methyl-2-[4-(trifluoromethyl)phenyl]benzene. InChIKey: UXVHCPVYQARYAR-UHFFFAOYSA-N.
| Molecular formula | C14H10ClF3 |
|---|---|
| Molecular weight | 270.67 g/mol |
| IUPAC name | 1-chloro-4-methyl-2-[4-(trifluoromethyl)phenyl]benzene |
| InChIKey | UXVHCPVYQARYAR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)Cl)C2=CC=C(C=C2)C(F)(F)F |
Computed by PubChem (NCBI)