CAS 787-49-5 is the registry number for 1-(Chloro(phenyl)methyl)-4-(trifluoromethyl)benzene, 97%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
1-[chloro(phenyl)methyl]-4-(trifluoromethyl)benzene (CAS 787-49-5) is a chemical compound with the molecular formula C14H10ClF3 and a molecular weight of 270.67 g/mol. IUPAC name: 1-[chloro(phenyl)methyl]-4-(trifluoromethyl)benzene. InChIKey: XORHOWOSRLIUMC-UHFFFAOYSA-N.
| Molecular formula | C14H10ClF3 |
|---|---|
| Molecular weight | 270.67 g/mol |
| IUPAC name | 1-[chloro(phenyl)methyl]-4-(trifluoromethyl)benzene |
| InChIKey | XORHOWOSRLIUMC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=C(C=C2)C(F)(F)F)Cl |
Computed by PubChem (NCBI)