CAS 1419798-91-6 is the registry number for 4-Chloro-4'-methyl-2-(trifluoromethyl)-1,1'-biphenyl, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g, 10g, 1g, 250mg.
4-chloro-1-(4-methylphenyl)-2-(trifluoromethyl)benzene (CAS 1419798-91-6) is a chemical compound with the molecular formula C14H10ClF3 and a molecular weight of 270.67 g/mol. IUPAC name: 4-chloro-1-(4-methylphenyl)-2-(trifluoromethyl)benzene. InChIKey: JDYHPBSAHWTSLM-UHFFFAOYSA-N.
| Molecular formula | C14H10ClF3 |
|---|---|
| Molecular weight | 270.67 g/mol |
| IUPAC name | 4-chloro-1-(4-methylphenyl)-2-(trifluoromethyl)benzene |
| InChIKey | JDYHPBSAHWTSLM-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=C(C=C(C=C2)Cl)C(F)(F)F |
Computed by PubChem (NCBI)