Products 1419798-91-6

CAS 1419798-91-6 is the registry number for 4-Chloro-4'-methyl-2-(trifluoromethyl)-1,1'-biphenyl, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g, 10g, 1g, 250mg.

Structural formula: {0} (CAS {1})

4-chloro-1-(4-methylphenyl)-2-(trifluoromethyl)benzene (CAS 1419798-91-6) is a chemical compound with the molecular formula C14H10ClF3 and a molecular weight of 270.67 g/mol. IUPAC name: 4-chloro-1-(4-methylphenyl)-2-(trifluoromethyl)benzene. InChIKey: JDYHPBSAHWTSLM-UHFFFAOYSA-N.

Identity
Molecular formulaC14H10ClF3
Molecular weight270.67 g/mol
IUPAC name4-chloro-1-(4-methylphenyl)-2-(trifluoromethyl)benzene
InChIKeyJDYHPBSAHWTSLM-UHFFFAOYSA-N
SMILESCC1=CC=C(C=C1)C2=C(C=C(C=C2)Cl)C(F)(F)F

Computed by PubChem (NCBI)