CAS 1261884-90-5 is the registry number for 1-(Difluoromethoxy)naphthalene-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g, 250mg.
4-(difluoromethoxy)naphthalene-1-carboxylic acid (CAS 1261884-90-5) is a chemical compound with the molecular formula C12H8F2O3 and a molecular weight of 238.19 g/mol. IUPAC name: 4-(difluoromethoxy)naphthalene-1-carboxylic acid. InChIKey: WAYDODGHSUEAMR-UHFFFAOYSA-N.
| Molecular formula | C12H8F2O3 |
|---|---|
| Molecular weight | 238.19 g/mol |
| IUPAC name | 4-(difluoromethoxy)naphthalene-1-carboxylic acid |
| InChIKey | WAYDODGHSUEAMR-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC=C2OC(F)F)C(=O)O |
Computed by PubChem (NCBI)