CAS 438222-04-9 appears in our catalog under these names: 5-(2,4-Difluorophenoxymethyl)furan-2-carbaldehyde, 5-(2,4-Difluoro-phenoxymethyl)-furan-2-carbaldehyde. Offered by: Biosynth, Fluorochem. Available pack sizes: 2,5g, 250mg, 1g.
5-[(2,4-difluorophenoxy)methyl]furan-2-carbaldehyde (CAS 438222-04-9) is a chemical compound with the molecular formula C12H8F2O3 and a molecular weight of 238.19 g/mol. IUPAC name: 5-[(2,4-difluorophenoxy)methyl]furan-2-carbaldehyde. InChIKey: ACPDVQWJOBDFHZ-UHFFFAOYSA-N.
| Molecular formula | C12H8F2O3 |
|---|---|
| Molecular weight | 238.19 g/mol |
| IUPAC name | 5-[(2,4-difluorophenoxy)methyl]furan-2-carbaldehyde |
| InChIKey | ACPDVQWJOBDFHZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)F)OCC2=CC=C(O2)C=O |
Computed by PubChem (NCBI)