CAS 2916870-35-2 is the registry number for Methyl 5,6-difluoro-4-hydroxy-2-naphthoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 5,6-difluoro-4-hydroxynaphthalene-2-carboxylate (CAS 2916870-35-2) is a chemical compound with the molecular formula C12H8F2O3 and a molecular weight of 238.19 g/mol. IUPAC name: methyl 5,6-difluoro-4-hydroxynaphthalene-2-carboxylate. InChIKey: HNBSYVHSHFVAMG-UHFFFAOYSA-N.
| Molecular formula | C12H8F2O3 |
|---|---|
| Molecular weight | 238.19 g/mol |
| IUPAC name | methyl 5,6-difluoro-4-hydroxynaphthalene-2-carboxylate |
| InChIKey | HNBSYVHSHFVAMG-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C2C(=C1)C=CC(=C2F)F)O |
Computed by PubChem (NCBI)