CAS 1261888-40-7 is the registry number for 3-Chloro-5-(2,4-dimethoxyphenyl)phenol. Offered by: Biosynth. Available pack sizes: 10000mg, 5000mg.
3-chloro-5-(2,4-dimethoxyphenyl)phenol (CAS 1261888-40-7) is a chemical compound with the molecular formula C14H13ClO3 and a molecular weight of 264.70 g/mol. IUPAC name: 3-chloro-5-(2,4-dimethoxyphenyl)phenol. InChIKey: NJAYWNAXTYOXRJ-UHFFFAOYSA-N.
| Molecular formula | C14H13ClO3 |
|---|---|
| Molecular weight | 264.70 g/mol |
| IUPAC name | 3-chloro-5-(2,4-dimethoxyphenyl)phenol |
| InChIKey | NJAYWNAXTYOXRJ-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)C2=CC(=CC(=C2)Cl)O)OC |
Computed by PubChem (NCBI)