CAS 1261978-93-1 is the registry number for 5-(4-Chloro-2-methoxyphenyl)-2-methoxyphenol. Offered by: Biosynth. Available pack sizes: 10000mg, 5000mg.
5-(4-chloro-2-methoxyphenyl)-2-methoxyphenol (CAS 1261978-93-1) is a chemical compound with the molecular formula C14H13ClO3 and a molecular weight of 264.70 g/mol. IUPAC name: 5-(4-chloro-2-methoxyphenyl)-2-methoxyphenol. InChIKey: KANRGTDHRVIJDK-UHFFFAOYSA-N.
| Molecular formula | C14H13ClO3 |
|---|---|
| Molecular weight | 264.70 g/mol |
| IUPAC name | 5-(4-chloro-2-methoxyphenyl)-2-methoxyphenol |
| InChIKey | KANRGTDHRVIJDK-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=C(C=C(C=C2)Cl)OC)O |
Computed by PubChem (NCBI)