CAS 438220-14-5 is the registry number for 5-(4-Chloro-3,5-dimethylphenoxymethyl)furan-2-carbaldehyde. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
5-[(4-chloro-3,5-dimethylphenoxy)methyl]furan-2-carbaldehyde (CAS 438220-14-5) is a chemical compound with the molecular formula C14H13ClO3 and a molecular weight of 264.70 g/mol. IUPAC name: 5-[(4-chloro-3,5-dimethylphenoxy)methyl]furan-2-carbaldehyde. InChIKey: GKDNOEWFSPXSAM-UHFFFAOYSA-N.
| Molecular formula | C14H13ClO3 |
|---|---|
| Molecular weight | 264.70 g/mol |
| IUPAC name | 5-[(4-chloro-3,5-dimethylphenoxy)methyl]furan-2-carbaldehyde |
| InChIKey | GKDNOEWFSPXSAM-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1Cl)C)OCC2=CC=C(O2)C=O |
Computed by PubChem (NCBI)