CAS 1261889-63-7 is the registry number for 3-(2,5-Difluorophenyl)phenol, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
3-(2,5-difluorophenyl)phenol (CAS 1261889-63-7) is a chemical compound with the molecular formula C12H8F2O and a molecular weight of 206.19 g/mol. IUPAC name: 3-(2,5-difluorophenyl)phenol. InChIKey: KYQHNXSUSYDZAJ-UHFFFAOYSA-N.
| Molecular formula | C12H8F2O |
|---|---|
| Molecular weight | 206.19 g/mol |
| IUPAC name | 3-(2,5-difluorophenyl)phenol |
| InChIKey | KYQHNXSUSYDZAJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)O)C2=C(C=CC(=C2)F)F |
Computed by PubChem (NCBI)