CAS 612092-34-9 is the registry number for 4-(2-Fluorophenyl)-2-fluorophenol, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
2-fluoro-4-(2-fluorophenyl)phenol (CAS 612092-34-9) is a chemical compound with the molecular formula C12H8F2O and a molecular weight of 206.19 g/mol. IUPAC name: 2-fluoro-4-(2-fluorophenyl)phenol. InChIKey: RJJBJXSYRNWSIP-UHFFFAOYSA-N.
| Molecular formula | C12H8F2O |
|---|---|
| Molecular weight | 206.19 g/mol |
| IUPAC name | 2-fluoro-4-(2-fluorophenyl)phenol |
| InChIKey | RJJBJXSYRNWSIP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC(=C(C=C2)O)F)F |
Computed by PubChem (NCBI)