CAS 202464-01-5 appears in our catalog under these names: 4-(2,3-Difluorophenyl)phenol, 95%, 4-(2,3-Difluorophenyl)phenol. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 5g, 1g, 10g.
4-(2,3-difluorophenyl)phenol (CAS 202464-01-5) is a chemical compound with the molecular formula C12H8F2O and a molecular weight of 206.19 g/mol. IUPAC name: 4-(2,3-difluorophenyl)phenol. InChIKey: BPNQXCRUPFDZGO-UHFFFAOYSA-N.
| Molecular formula | C12H8F2O |
|---|---|
| Molecular weight | 206.19 g/mol |
| IUPAC name | 4-(2,3-difluorophenyl)phenol |
| InChIKey | BPNQXCRUPFDZGO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)F)C2=CC=C(C=C2)O |
Computed by PubChem (NCBI)