CAS 1261896-17-6 is the registry number for 4-(2,5-Dichlorophenyl)-2-hydroxypyridine, 97%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
4-(2,5-dichlorophenyl)-1H-pyridin-2-one (CAS 1261896-17-6) is a chemical compound with the molecular formula C11H7Cl2NO and a molecular weight of 240.08 g/mol. IUPAC name: 4-(2,5-dichlorophenyl)-1H-pyridin-2-one. InChIKey: BYHCHRZKOROJFM-UHFFFAOYSA-N.
| Molecular formula | C11H7Cl2NO |
|---|---|
| Molecular weight | 240.08 g/mol |
| IUPAC name | 4-(2,5-dichlorophenyl)-1H-pyridin-2-one |
| InChIKey | BYHCHRZKOROJFM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)C2=CC(=O)NC=C2)Cl |
Computed by PubChem (NCBI)