CAS 708288-96-4 is the registry number for 5-(2,4-Dichlorophenyl)-1H-pyrrole-2-carbaldehyde, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(2,4-dichlorophenyl)-1H-pyrrole-2-carbaldehyde (CAS 708288-96-4) is a chemical compound with the molecular formula C11H7Cl2NO and a molecular weight of 240.08 g/mol. IUPAC name: 5-(2,4-dichlorophenyl)-1H-pyrrole-2-carbaldehyde. InChIKey: SFCHNSMCZGBOTP-UHFFFAOYSA-N.
| Molecular formula | C11H7Cl2NO |
|---|---|
| Molecular weight | 240.08 g/mol |
| IUPAC name | 5-(2,4-dichlorophenyl)-1H-pyrrole-2-carbaldehyde |
| InChIKey | SFCHNSMCZGBOTP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)C2=CC=C(N2)C=O |
Computed by PubChem (NCBI)