CAS 948291-36-9 appears in our catalog under these names: 2,5-Dichloro-8-methylquinoline-3-carboxaldehyde, 95%, 2,5-Dichloro-8-methylquinoline-3-carboxaldehyde. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 500mg.
2,5-dichloro-8-methylquinoline-3-carbaldehyde (CAS 948291-36-9) is a chemical compound with the molecular formula C11H7Cl2NO and a molecular weight of 240.08 g/mol. IUPAC name: 2,5-dichloro-8-methylquinoline-3-carbaldehyde. InChIKey: MZAQCBDOHHPKOV-UHFFFAOYSA-N.
| Molecular formula | C11H7Cl2NO |
|---|---|
| Molecular weight | 240.08 g/mol |
| IUPAC name | 2,5-dichloro-8-methylquinoline-3-carbaldehyde |
| InChIKey | MZAQCBDOHHPKOV-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=C(C=C1)Cl)C=C(C(=N2)Cl)C=O |
Computed by PubChem (NCBI)