CAS 1261910-60-4 appears in our catalog under these names: 4-(2-Chloro-4-ethoxyphenyl)phenol, 96%, 2'-Chloro-4'-ethoxy-(1,1'-biphenyl)-4-ol, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g.
4-(2-chloro-4-ethoxyphenyl)phenol (CAS 1261910-60-4) is a chemical compound with the molecular formula C14H13ClO2 and a molecular weight of 248.70 g/mol. IUPAC name: 4-(2-chloro-4-ethoxyphenyl)phenol. InChIKey: ANKIOAYESUDKNX-UHFFFAOYSA-N.
| Molecular formula | C14H13ClO2 |
|---|---|
| Molecular weight | 248.70 g/mol |
| IUPAC name | 4-(2-chloro-4-ethoxyphenyl)phenol |
| InChIKey | ANKIOAYESUDKNX-UHFFFAOYSA-N |
| SMILES | CCOC1=CC(=C(C=C1)C2=CC=C(C=C2)O)Cl |
Computed by PubChem (NCBI)