CAS 536974-87-5 appears in our catalog under these names: (4-Benzyloxy-3-chloro-phenyl)-methanol, 95%, 4-Benzyloxy-3-chlorobenzyl alcohol, 98%, 4-Benzyloxy-3-chlorobenzyl alcohol, (4-(Benzyloxy)-3-chlorophenyl)methanol. Offered by: Combi-blocks, AmBeed, Biosynth, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
(3-chloro-4-phenylmethoxyphenyl)methanol (CAS 536974-87-5) is a chemical compound with the molecular formula C14H13ClO2 and a molecular weight of 248.70 g/mol. IUPAC name: (3-chloro-4-phenylmethoxyphenyl)methanol. InChIKey: CKISKJPLMSLTDC-UHFFFAOYSA-N.
| Molecular formula | C14H13ClO2 |
|---|---|
| Molecular weight | 248.70 g/mol |
| IUPAC name | (3-chloro-4-phenylmethoxyphenyl)methanol |
| InChIKey | CKISKJPLMSLTDC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=C(C=C2)CO)Cl |
Computed by PubChem (NCBI)