CAS 219764-60-0 appears in our catalog under these names: 4-Benzyloxy-2-chlorobenzyl alcohol, 95%, 4-Benzyloxy-2-chlorobenzyl alcohol, 4-Benzyloxy-2-chlorobenzyl alcohol, min. 95 %, 500 mg, 4-Benzyloxy-2-chlorobenzyl alcohol, min. 95 %, 1 g, 4-Benzyloxy-2-chlorobenzyl alcohol, min. 95 %, 2 g. Offered by: Combi-blocks, Biosynth, Roth. Available pack sizes: 1g, 25g, 10g, 5g, 2g, 500mg.
(2-chloro-4-phenylmethoxyphenyl)methanol (CAS 219764-60-0) is a chemical compound with the molecular formula C14H13ClO2 and a molecular weight of 248.70 g/mol. IUPAC name: (2-chloro-4-phenylmethoxyphenyl)methanol. InChIKey: SSQUZFZUJDONRR-UHFFFAOYSA-N.
| Molecular formula | C14H13ClO2 |
|---|---|
| Molecular weight | 248.70 g/mol |
| IUPAC name | (2-chloro-4-phenylmethoxyphenyl)methanol |
| InChIKey | SSQUZFZUJDONRR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC(=C(C=C2)CO)Cl |
Computed by PubChem (NCBI)