CAS 152614-95-4 appears in our catalog under these names: Pseudoephedrine tert–butyl Carbamate, Pseudoephedrine tert-butyl carbamate. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 5mg, 5 mg, 1 mg.
Tert-butyl N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methylcarbamate (CAS 152614-95-4) is a chemical compound with the molecular formula C15H23NO3 and a molecular weight of 265.35 g/mol. IUPAC name: tert-butyl N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methylcarbamate. InChIKey: SIKODEFLCMOILM-WCQYABFASA-N.
| Molecular formula | C15H23NO3 |
|---|---|
| Molecular weight | 265.35 g/mol |
| IUPAC name | tert-butyl N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methylcarbamate |
| InChIKey | SIKODEFLCMOILM-WCQYABFASA-N |
| SMILES | C[C@@H]([C@H](C1=CC=CC=C1)O)N(C)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)