Products 1261925-85-2

CAS 1261925-85-2 is the registry number for 5-Fluoro-3-(thiophen-3-yl)benzoic acid, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

3-fluoro-5-thiophen-3-ylbenzoic acid (CAS 1261925-85-2) is a chemical compound with the molecular formula C11H7FO2S and a molecular weight of 222.24 g/mol. IUPAC name: 3-fluoro-5-thiophen-3-ylbenzoic acid. InChIKey: HIPLDDAWLQXWFB-UHFFFAOYSA-N.

Identity
Molecular formulaC11H7FO2S
Molecular weight222.24 g/mol
IUPAC name3-fluoro-5-thiophen-3-ylbenzoic acid
InChIKeyHIPLDDAWLQXWFB-UHFFFAOYSA-N
SMILESC1=CSC=C1C2=CC(=CC(=C2)F)C(=O)O

Computed by PubChem (NCBI)