CAS 926205-45-0 is the registry number for 2-Fluoro-5-(thiophen-2-yl)benzoic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
2-fluoro-5-thiophen-2-ylbenzoic acid (CAS 926205-45-0) is a chemical compound with the molecular formula C11H7FO2S and a molecular weight of 222.24 g/mol. IUPAC name: 2-fluoro-5-thiophen-2-ylbenzoic acid. InChIKey: AJZQGTREOWCZIG-UHFFFAOYSA-N.
| Molecular formula | C11H7FO2S |
|---|---|
| Molecular weight | 222.24 g/mol |
| IUPAC name | 2-fluoro-5-thiophen-2-ylbenzoic acid |
| InChIKey | AJZQGTREOWCZIG-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C2=CC(=C(C=C2)F)C(=O)O |
Computed by PubChem (NCBI)