Products 1261993-00-3

CAS 1261993-00-3 is the registry number for 2-Fluoro-5-(thiophen-3-yl)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

2-fluoro-5-thiophen-3-ylbenzoic acid (CAS 1261993-00-3) is a chemical compound with the molecular formula C11H7FO2S and a molecular weight of 222.24 g/mol. IUPAC name: 2-fluoro-5-thiophen-3-ylbenzoic acid. InChIKey: CYISDRCRIVBKGS-UHFFFAOYSA-N.

Identity
Molecular formulaC11H7FO2S
Molecular weight222.24 g/mol
IUPAC name2-fluoro-5-thiophen-3-ylbenzoic acid
InChIKeyCYISDRCRIVBKGS-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1C2=CSC=C2)C(=O)O)F

Computed by PubChem (NCBI)